C19H22O5 — CID 14139647
4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane-2,3-diol (PubChem CID 14139647) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane-2,3-diol.
| Compound Name | 4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane-2,3-diol |
|---|---|
| PubChem CID | 14139647 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-phenylmethoxy-5-(phenylmethoxymethyl)oxolane-2,3-diol |
| SMILES | OC1OC(COCc2ccccc2)C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C19H22O5/c20-17-18(23-12-15-9-5-2-6-10-15)16(24-19(17)21)13-22-11-14-7-3-1-4-8-14/h1-10,16-21H,11-13H2 |
| InChIKey | LYHOPDIJCJJVNG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |