C22H28O4 — CID 91212823
(2S,4R,5S)-2,3-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol (PubChem CID 91212823) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (2S,4R,5S)-2,3-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol.
| Compound Name | (2S,4R,5S)-2,3-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 91212823 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (2S,4R,5S)-2,3-dimethyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol |
| SMILES | CC1[C@H](C)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C22H28O4/c1-16-17(2)26-20(15-24-13-18-9-5-3-6-10-18)22(21(16)23)25-14-19-11-7-4-8-12-19/h3-12,16-17,20-23H,13-15H2,1-2H3/t16?,17-,20?,21+,22+/m0/s1 |
| InChIKey | FUENAMVNKJNEAL-CEIDEDIVSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |