C27H40O5Si — CID 71166590
(2R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol (PubChem CID 71166590) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (2R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol.
| Compound Name | (2R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 71166590 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-4-ol |
| SMILES | C[C@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H40O5Si/c1-20-25(32-33(5,6)27(2,3)4)24(28)26(30-18-22-15-11-8-12-16-22)23(31-20)19-29-17-21-13-9-7-10-14-21/h7-16,20,23-26,28H,17-19H2,1-6H3/t20-,23?,24-,25?,26-/m1/s1 |
| InChIKey | ZXYPYJNIKSBCMU-UQQDFARSSA-N |
| XLogP | 5.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|