C30H36O6 — CID 101203720
(2S,3R,4R,5R,6R)-2-(2-hydroxypropan-2-yl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 101203720) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-(2-hydroxypropan-2-yl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2S,3R,4R,5R,6R)-2-(2-hydroxypropan-2-yl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 101203720 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-(2-hydroxypropan-2-yl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC(C)(O)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C30H36O6/c1-30(2,32)29-26(31)28(35-20-24-16-10-5-11-17-24)27(34-19-23-14-8-4-9-15-23)25(36-29)21-33-18-22-12-6-3-7-13-22/h3-17,25-29,31-32H,18-21H2,1-2H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | JYOMWZMSDMDTMY-JPHCZMGXSA-N |
| XLogP | 4.27 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |