C38H42F2O6 — CID 71513608
1,1-difluoro-2-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propan-2-ol (PubChem CID 71513608) has the molecular formula C38H42F2O6 and a molecular weight of 632.74 g/mol. Its IUPAC name is 1,1-difluoro-2-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propan-2-ol.
| Compound Name | 1,1-difluoro-2-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 71513608 |
| Molecular Formula | C38H42F2O6 |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 1,1-difluoro-2-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propan-2-ol |
| SMILES | CC(C)(O)C(F)(F)[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H42F2O6/c1-37(2,41)38(39,40)36-35(45-26-31-21-13-6-14-22-31)34(44-25-30-19-11-5-12-20-30)33(43-24-29-17-9-4-10-18-29)32(46-36)27-42-23-28-15-7-3-8-16-28/h3-22,32-36,41H,23-27H2,1-2H3/t32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | VCKVPNRLHMVHLD-FGZSBDNFSA-N |
| XLogP | 7.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |