C43H42BrF3O6 — CID 162515525
1-[4-bromo-2-(trifluoromethyl)phenyl]-1-[(2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol (PubChem CID 162515525) has the molecular formula C43H42BrF3O6 and a molecular weight of 791.70 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-1-[(2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-1-[(2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 162515525 |
| Molecular Formula | C43H42BrF3O6 |
| Molecular Weight | 791.70 g/mol |
| Exact Mass | 790.21 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-1-[(2S,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol |
| SMILES | CC(O)(c1ccc(Br)cc1C(F)(F)F)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H42BrF3O6/c1-42(48,35-23-22-34(44)24-36(35)43(45,46)47)41-40(52-28-33-20-12-5-13-21-33)39(51-27-32-18-10-4-11-19-32)38(50-26-31-16-8-3-9-17-31)37(53-41)29-49-25-30-14-6-2-7-15-30/h2-24,37-41,48H,25-29H2,1H3/t37-,38-,39+,40+,41+,42?/m1/s1 |
| InChIKey | MOQRQDXFZVDMMR-KIDUSGKYSA-N |
| XLogP | 9.42 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.70 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |