C34H36O5S — CID 102081049
(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-thiol (PubChem CID 102081049) has the molecular formula C34H36O5S and a molecular weight of 556.72 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-thiol.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-thiol |
|---|---|
| PubChem CID | 102081049 |
| Molecular Formula | C34H36O5S |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-thiol |
| SMILES | S[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H36O5S/c40-34-33(38-24-29-19-11-4-12-20-29)32(37-23-28-17-9-3-10-18-28)31(36-22-27-15-7-2-8-16-27)30(39-34)25-35-21-26-13-5-1-6-14-26/h1-20,30-34,40H,21-25H2/t30-,31-,32+,33+,34-/m1/s1 |
| InChIKey | LJMMNXCZSYDRSR-ZYSDIQSLSA-N |
| XLogP | 6.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|