C26H28O4S — CID 102407549
(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-thiol (PubChem CID 102407549) has the molecular formula C26H28O4S and a molecular weight of 436.57 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-thiol.
| Compound Name | (2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-thiol |
|---|---|
| PubChem CID | 102407549 |
| Molecular Formula | C26H28O4S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-thiol |
| SMILES | S[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O4S/c31-26-25(29-18-22-14-8-3-9-15-22)24(28-17-21-12-6-2-7-13-21)23(30-26)19-27-16-20-10-4-1-5-11-20/h1-15,23-26,31H,16-19H2/t23-,24-,25+,26-/m1/s1 |
| InChIKey | MABPURPIBMVPNU-FXSWLTOZSA-N |
| XLogP | 5.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|