C26H27ClO4 — CID 154723148
(2R,5R)-2-chloro-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane (PubChem CID 154723148) has the molecular formula C26H27ClO4 and a molecular weight of 438.95 g/mol. Its IUPAC name is (2R,5R)-2-chloro-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,5R)-2-chloro-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 154723148 |
| Molecular Formula | C26H27ClO4 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (2R,5R)-2-chloro-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane |
| SMILES | Cl[C@H]1O[C@H](COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C26H27ClO4/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-26H,16-19H2/t23-,24?,25?,26+/m1/s1 |
| InChIKey | YBBDIXWREGHZRM-XWPUUTJGSA-N |
| XLogP | 5.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|