C28H31ClO4 — CID 58242550
(2R,3R,4S,5R,6R)-2-chloro-6-ethyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 58242550) has the molecular formula C28H31ClO4 and a molecular weight of 467.01 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-chloro-6-ethyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-chloro-6-ethyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 58242550 |
| Molecular Formula | C28H31ClO4 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-chloro-6-ethyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CC[C@H]1O[C@H](Cl)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H31ClO4/c1-2-24-25(30-18-21-12-6-3-7-13-21)26(31-19-22-14-8-4-9-15-22)27(28(29)33-24)32-20-23-16-10-5-11-17-23/h3-17,24-28H,2,18-20H2,1H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | BBZGOHHPQZGSRC-DFLSAPQXSA-N |
| XLogP | 6.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|