C14H19FO2 — CID 122695335
(2R,3R,5S)-2-ethyl-5-fluoro-4-methyl-3-phenylmethoxyoxolane (PubChem CID 122695335) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is (2R,3R,5S)-2-ethyl-5-fluoro-4-methyl-3-phenylmethoxyoxolane.
| Compound Name | (2R,3R,5S)-2-ethyl-5-fluoro-4-methyl-3-phenylmethoxyoxolane |
|---|---|
| PubChem CID | 122695335 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2R,3R,5S)-2-ethyl-5-fluoro-4-methyl-3-phenylmethoxyoxolane |
| SMILES | CC[C@H]1O[C@@H](F)C(C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19FO2/c1-3-12-13(10(2)14(15)17-12)16-9-11-7-5-4-6-8-11/h4-8,10,12-14H,3,9H2,1-2H3/t10?,12-,13-,14-/m1/s1 |
| InChIKey | LLBLAZGDYFOKOJ-FYFXECOGSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |