C14H20O3 — CID 121322520
(2R,3R,5R)-5-ethyl-3-methyl-4-phenylmethoxyoxolan-2-ol (PubChem CID 121322520) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R,3R,5R)-5-ethyl-3-methyl-4-phenylmethoxyoxolan-2-ol.
| Compound Name | (2R,3R,5R)-5-ethyl-3-methyl-4-phenylmethoxyoxolan-2-ol |
|---|---|
| PubChem CID | 121322520 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2R,3R,5R)-5-ethyl-3-methyl-4-phenylmethoxyoxolan-2-ol |
| SMILES | CC[C@H]1O[C@@H](O)[C@H](C)C1OCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-3-12-13(10(2)14(15)17-12)16-9-11-7-5-4-6-8-11/h4-8,10,12-15H,3,9H2,1-2H3/t10-,12-,13?,14-/m1/s1 |
| InChIKey | WAJSJLZTWFIJGD-RWDKGTSBSA-N |
| XLogP | 2.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |