C26H34O3 — CID 118175464
(2R,3S,4S,5S,6S)-2-ethyl-3-methyl-6-(2-methylprop-2-enyl)-4,5-bis(phenylmethoxy)oxane (PubChem CID 118175464) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-ethyl-3-methyl-6-(2-methylprop-2-enyl)-4,5-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3S,4S,5S,6S)-2-ethyl-3-methyl-6-(2-methylprop-2-enyl)-4,5-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 118175464 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-ethyl-3-methyl-6-(2-methylprop-2-enyl)-4,5-bis(phenylmethoxy)oxane |
| SMILES | C=C(C)C[C@@H]1O[C@H](CC)C(C)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H34O3/c1-5-23-20(4)25(27-17-21-12-8-6-9-13-21)26(24(29-23)16-19(2)3)28-18-22-14-10-7-11-15-22/h6-15,20,23-26H,2,5,16-18H2,1,3-4H3/t20?,23-,24+,25+,26+/m1/s1 |
| InChIKey | WYCOCQFUNHIGNP-DGEOFYIOSA-N |
| XLogP | 5.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|