C32H42O4 — CID 165103562
(2R,3R,4S,5R,6R)-2-(1-adamantyloxy)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane (PubChem CID 165103562) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(1-adamantyloxy)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-(1-adamantyloxy)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 165103562 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(1-adamantyloxy)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane |
| SMILES | CC[C@H]1O[C@H](OC23CC4CC(CC(C4)C2)C3)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C32H42O4/c1-3-28-22(2)29(33-20-23-10-6-4-7-11-23)30(34-21-24-12-8-5-9-13-24)31(35-28)36-32-17-25-14-26(18-32)16-27(15-25)19-32/h4-13,22,25-31H,3,14-21H2,1-2H3/t22-,25?,26?,27?,28-,29+,30-,31-,32?/m1/s1 |
| InChIKey | YTDDZTLZAOSAEP-ASRYAHPGSA-N |
| XLogP | 6.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |