C38H41NO5S — CID 25194511
(2R,4aS,6S,7S,8S,8aS)-6-(1-adamantyloxy)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxathiine-2-carbonitrile (PubChem CID 25194511) has the molecular formula C38H41NO5S and a molecular weight of 623.82 g/mol. Its IUPAC name is (2R,4aS,6S,7S,8S,8aS)-6-(1-adamantyloxy)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxathiine-2-carbonitrile.
| Compound Name | (2R,4aS,6S,7S,8S,8aS)-6-(1-adamantyloxy)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxathiine-2-carbonitrile |
|---|---|
| PubChem CID | 25194511 |
| Molecular Formula | C38H41NO5S |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | (2R,4aS,6S,7S,8S,8aS)-6-(1-adamantyloxy)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxathiine-2-carbonitrile |
| SMILES | N#C[C@]1(c2ccccc2)O[C@H]2[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OC34CC5CC(CC(C5)C3)C4)O[C@@H]2CS1 |
| InChI | InChI=1S/C38H41NO5S/c39-25-38(31-14-8-3-9-15-31)43-33-32(24-45-38)42-36(44-37-19-28-16-29(20-37)18-30(17-28)21-37)35(41-23-27-12-6-2-7-13-27)34(33)40-22-26-10-4-1-5-11-26/h1-15,28-30,32-36H,16-24H2/t28?,29?,30?,32-,33-,34+,35+,36+,37?,38+/m1/s1 |
| InChIKey | SOLJJPAHTXCVHS-VDCMHWSKSA-N |
| XLogP | 7.38 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |