C29H31NO5 — CID 135027342
2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetonitrile (PubChem CID 135027342) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetonitrile.
| Compound Name | 2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetonitrile |
|---|---|
| PubChem CID | 135027342 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetonitrile |
| SMILES | CO[C@H]1O[C@H](CC#N)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H31NO5/c1-31-29-28(34-21-24-15-9-4-10-16-24)27(33-20-23-13-7-3-8-14-23)26(25(35-29)17-18-30)32-19-22-11-5-2-6-12-22/h2-16,25-29H,17,19-21H2,1H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | NDZNJHZIANQKEC-PNHLWVRCSA-N |
| XLogP | 5.03 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |