C18H24O6 — CID 123547448
4,12,12-trimethyl-7-phenylmethoxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 123547448) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 4,12,12-trimethyl-7-phenylmethoxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | 4,12,12-trimethyl-7-phenylmethoxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 123547448 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4,12,12-trimethyl-7-phenylmethoxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC1OC2C(OCc3ccccc3)OC3COC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C18H24O6/c1-11-21-15-14-13(10-20-18(2,3)24-14)23-17(16(15)22-11)19-9-12-7-5-4-6-8-12/h4-8,11,13-17H,9-10H2,1-3H3 |
| InChIKey | NDJJYZRJLRNSGS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |