C19H26O6 — CID 11046334
(2E)-2-[(4aR,6S,8R,8aS)-6-methoxy-2,2-dimethyl-8-phenylmethoxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-ylidene]ethanol (PubChem CID 11046334) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (2E)-2-[(4aR,6S,8R,8aS)-6-methoxy-2,2-dimethyl-8-phenylmethoxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-ylidene]ethanol.
| Compound Name | (2E)-2-[(4aR,6S,8R,8aS)-6-methoxy-2,2-dimethyl-8-phenylmethoxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-ylidene]ethanol |
|---|---|
| PubChem CID | 11046334 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2E)-2-[(4aR,6S,8R,8aS)-6-methoxy-2,2-dimethyl-8-phenylmethoxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-ylidene]ethanol |
| SMILES | CO[C@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](OCc2ccccc2)/C1=C\CO |
| InChI | InChI=1S/C19H26O6/c1-19(2)23-12-15-17(25-19)16(14(9-10-20)18(21-3)24-15)22-11-13-7-5-4-6-8-13/h4-9,15-18,20H,10-12H2,1-3H3/b14-9+/t15-,16-,17-,18+/m1/s1 |
| InChIKey | WQSVZSLYIWCACW-FCHQSTINSA-N |
| XLogP | 2.01 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|