C17H22O6 — CID 98391257
(1S,2R,6R,7S,9R)-9-methoxy-4,4-dimethyl-1-phenylmethoxy-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecane (PubChem CID 98391257) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is (1S,2R,6R,7S,9R)-9-methoxy-4,4-dimethyl-1-phenylmethoxy-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecane.
| Compound Name | (1S,2R,6R,7S,9R)-9-methoxy-4,4-dimethyl-1-phenylmethoxy-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 98391257 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (1S,2R,6R,7S,9R)-9-methoxy-4,4-dimethyl-1-phenylmethoxy-3,5,8,10-tetraoxatricyclo[5.2.2.02,6]undecane |
| SMILES | CO[C@@H]1O[C@H]2CO[C@@]1(OCc1ccccc1)[C@@H]1OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H22O6/c1-16(2)22-13-12-10-20-17(14(13)23-16,15(18-3)21-12)19-9-11-7-5-4-6-8-11/h4-8,12-15H,9-10H2,1-3H3/t12-,13+,14+,15+,17-/m0/s1 |
| InChIKey | SBEWAOCFMZWMSQ-GHYKFQNRSA-N |
| XLogP | 1.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |