C22H30O8 — CID 71169359
[(1R,2S,7R,8S)-8-methoxy-4,4,7,13,13-pentamethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate (PubChem CID 71169359) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [(1R,2S,7R,8S)-8-methoxy-4,4,7,13,13-pentamethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate.
| Compound Name | [(1R,2S,7R,8S)-8-methoxy-4,4,7,13,13-pentamethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 71169359 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(1R,2S,7R,8S)-8-methoxy-4,4,7,13,13-pentamethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
| SMILES | CO[C@H]1OC2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)OC2[C@@]1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30O8/c1-20(2)25-12-14-15(27-20)16-17(29-21(3,4)28-16)22(5,19(24-6)26-14)30-18(23)13-10-8-7-9-11-13/h7-11,14-17,19H,12H2,1-6H3/t14?,15-,16+,17?,19+,22-/m1/s1 |
| InChIKey | PDFGJWMJGLOADA-IFECJWDUSA-N |
| XLogP | 2.64 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |