C19H24O7 — CID 101406715
[(4'aS,7'S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine]-7'-yl] benzoate (PubChem CID 101406715) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is [(4'aS,7'S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine]-7'-yl] benzoate.
| Compound Name | [(4'aS,7'S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine]-7'-yl] benzoate |
|---|---|
| PubChem CID | 101406715 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(4'aS,7'S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine]-7'-yl] benzoate |
| SMILES | CC1(C)OC[C@@H]2OC3(COC(C)(C)O3)[C@@H](OC(=O)c3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C19H24O7/c1-17(2)21-10-13-14(25-17)15(19(24-13)11-22-18(3,4)26-19)23-16(20)12-8-6-5-7-9-12/h5-9,13-15H,10-11H2,1-4H3/t13-,14+,15-,19?/m0/s1 |
| InChIKey | KDVFTHHTJMIKCE-FRLFKWGPSA-N |
| XLogP | 2.24 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |