C21H28O8 — CID 71207104
[(1R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate (PubChem CID 71207104) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(1R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate.
| Compound Name | [(1R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
|---|---|
| PubChem CID | 71207104 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(1R,8R)-8-methoxy-4,4,13,13-tetramethyl-3,5,9,12,14-pentaoxatricyclo[8.4.0.02,6]tetradecan-7-yl] benzoate |
| SMILES | CO[C@@H]1OC2COC(C)(C)O[C@H]2C2OC(C)(C)OC2C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28O8/c1-20(2)24-11-13-14(27-20)15-16(29-21(3,4)28-15)17(19(23-5)25-13)26-18(22)12-9-7-6-8-10-12/h6-10,13-17,19H,11H2,1-5H3/t13?,14-,15?,16?,17?,19-/m1/s1 |
| InChIKey | LNWYSZWGIXPKDZ-AILDWPBDSA-N |
| XLogP | 2.25 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |