C17H22O6 — CID 57220921
[(3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] benzoate (PubChem CID 57220921) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] benzoate.
| Compound Name | [(3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] benzoate |
|---|---|
| PubChem CID | 57220921 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] benzoate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H22O6/c1-10-12(21-15(18)11-8-6-5-7-9-11)13-14(16(19-4)20-10)23-17(2,3)22-13/h5-10,12-14,16H,1-4H3/t10-,12-,13+,14+,16+/m0/s1 |
| InChIKey | RTLLRDPZZTULOI-LDYHSIQDSA-N |
| XLogP | 2.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |