C21H26O8 — CID 139184888
[(1S,3S,7R,9R)-8-acetyloxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl] benzoate (PubChem CID 139184888) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is [(1S,3S,7R,9R)-8-acetyloxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl] benzoate.
| Compound Name | [(1S,3S,7R,9R)-8-acetyloxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl] benzoate |
|---|---|
| PubChem CID | 139184888 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [(1S,3S,7R,9R)-8-acetyloxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl] benzoate |
| SMILES | CC(=O)OC1[C@@H]2OC(C)(C)O[C@@H]2C(OC(=O)c2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C21H26O8/c1-11(22)24-13-15-17(28-20(2,3)26-15)14(18-16(13)27-21(4,5)29-18)25-19(23)12-9-7-6-8-10-12/h6-10,13-18H,1-5H3/t13?,14?,15-,16-,17+,18+/m0/s1 |
| InChIKey | VLGXCQADTBBXDF-DGMLVCQYSA-N |
| XLogP | 2.20 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |