C24H24O6 — CID 11567702
[(3aR,4R,5R,7aR)-4-benzoyloxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] benzoate (PubChem CID 11567702) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(3aR,4R,5R,7aR)-4-benzoyloxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,7aR)-4-benzoyloxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] benzoate |
|---|---|
| PubChem CID | 11567702 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(3aR,4R,5R,7aR)-4-benzoyloxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] benzoate |
| SMILES | CC1=C[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H24O6/c1-15-14-18(27-22(25)16-10-6-4-7-11-16)20(21-19(15)29-24(2,3)30-21)28-23(26)17-12-8-5-9-13-17/h4-14,18-21H,1-3H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | ZAPHHVPPHLOITM-XRXFAXGQSA-N |
| XLogP | 3.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|