C15H15NO5 — CID 11392114
[(3aR,5R,6S,6aR)-5-cyano-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate (PubChem CID 11392114) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-cyano-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-cyano-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
|---|---|
| PubChem CID | 11392114 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-cyano-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H](C#N)[C@H](OC(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C15H15NO5/c1-15(2)20-12-11(10(8-16)18-14(12)21-15)19-13(17)9-6-4-3-5-7-9/h3-7,10-12,14H,1-2H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | HROBGFRKGLVXDL-GFQSEFKGSA-N |
| XLogP | 1.61 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |