C16H18O6 — CID 23327283
[(1R,2S,6S,7R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] benzoate (PubChem CID 23327283) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [(1R,2S,6S,7R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] benzoate.
| Compound Name | [(1R,2S,6S,7R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] benzoate |
|---|---|
| PubChem CID | 23327283 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(1R,2S,6S,7R,8S)-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl] benzoate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@H]1CO[C@@H](O1)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O6/c1-16(2)21-11-10-8-18-15(19-10)13(12(11)22-16)20-14(17)9-6-4-3-5-7-9/h3-7,10-13,15H,8H2,1-2H3/t10-,11+,12+,13-,15+/m1/s1 |
| InChIKey | XROOSVMIBOCEOO-KDBYPZKRSA-N |
| XLogP | 1.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |