About (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate
(2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate (PubChem CID 569399) has the molecular formula C13H14O6
and a molecular weight of 266.25 g/mol. Its IUPAC name is (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate.
Analyze (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate?
The IUPAC name of (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate (CID 569399) is (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate.
What is the SMILES notation for (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate?
The canonical SMILES for (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate is O=C(OC1C2OCC(O2)C(O)C1O)c1ccccc1.
What is the InChIKey of (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate?
The InChIKey is IQDNMBBGEADARR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O6/c14-9-8-6-17-13(18-8)11(10(9)15)19-12(16)7-4-2-1-3-5-7/h1-5,8-11,13-15H,6H2.
What are the key properties of (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate?
(2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate has a molecular weight of 266.25 g/mol, XLogP of -0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl) benzoate is sourced from PubChem (CID 569399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).