C19H18O7 — CID 101108085
[(2R,3R,4S,5S)-2-benzoyloxy-4,5-dihydroxyoxan-3-yl] benzoate (PubChem CID 101108085) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-benzoyloxy-4,5-dihydroxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S)-2-benzoyloxy-4,5-dihydroxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101108085 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [(2R,3R,4S,5S)-2-benzoyloxy-4,5-dihydroxyoxan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1OC[C@H](O)[C@H](O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O7/c20-14-11-24-19(26-18(23)13-9-5-2-6-10-13)16(15(14)21)25-17(22)12-7-3-1-4-8-12/h1-10,14-16,19-21H,11H2/t14-,15-,16+,19+/m0/s1 |
| InChIKey | AWNADEXWHXWRCO-YIOZNXECSA-N |
| XLogP | 1.15 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |