C12H13ClO5 — CID 67675297
[(2S,3R,4R,5R)-2-chloro-4,5-dihydroxyoxan-3-yl] benzoate (PubChem CID 67675297) has the molecular formula C12H13ClO5 and a molecular weight of 272.68 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-chloro-4,5-dihydroxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R)-2-chloro-4,5-dihydroxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 67675297 |
| Molecular Formula | C12H13ClO5 |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | [(2S,3R,4R,5R)-2-chloro-4,5-dihydroxyoxan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@H](O)[C@H](O)CO[C@H]1Cl)c1ccccc1 |
| InChI | InChI=1S/C12H13ClO5/c13-11-10(9(15)8(14)6-17-11)18-12(16)7-4-2-1-3-5-7/h1-5,8-11,14-15H,6H2/t8-,9-,10-,11-/m1/s1 |
| InChIKey | WWCNDTOWOPKNRA-GWOFURMSSA-N |
| XLogP | 0.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|