C12H14O5 — CID 134427493
[(3R,4S)-4-hydroxy-2-methoxyoxolan-3-yl] benzoate (PubChem CID 134427493) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-2-methoxyoxolan-3-yl] benzoate.
| Compound Name | [(3R,4S)-4-hydroxy-2-methoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 134427493 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(3R,4S)-4-hydroxy-2-methoxyoxolan-3-yl] benzoate |
| SMILES | COC1OC[C@H](O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O5/c1-15-12-10(9(13)7-16-12)17-11(14)8-5-3-2-4-6-8/h2-6,9-10,12-13H,7H2,1H3/t9-,10+,12?/m0/s1 |
| InChIKey | MMRIMUYXZXKPDP-YPBKCWQDSA-N |
| XLogP | 0.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |