C15H19NO5 — CID 139409454
[(2S,3S,4S,5S)-5-amino-4-hydroxy-2-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 139409454) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-5-amino-4-hydroxy-2-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5S)-5-amino-4-hydroxy-2-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 139409454 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [(2S,3S,4S,5S)-5-amino-4-hydroxy-2-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@H]1OC[C@H](N)[C@H](O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-2-8-19-15-13(12(17)11(16)9-20-15)21-14(18)10-6-4-3-5-7-10/h2-7,11-13,15,17H,1,8-9,16H2/t11-,12-,13-,15-/m0/s1 |
| InChIKey | AQBVOSSDGTZWGR-ABHRYQDASA-N |
| XLogP | 0.46 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|