C18H22O7 — CID 11163924
[(2S,3S,4S,5R,6R)-4-acetyloxy-5-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 11163924) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-4-acetyloxy-5-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5R,6R)-4-acetyloxy-5-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11163924 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-4-acetyloxy-5-hydroxy-2-methyl-6-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccccc2)[C@@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C18H22O7/c1-4-10-22-18-14(20)16(24-12(3)19)15(11(2)23-18)25-17(21)13-8-6-5-7-9-13/h4-9,11,14-16,18,20H,1,10H2,2-3H3/t11-,14+,15-,16-,18+/m0/s1 |
| InChIKey | UONAYEKGQCNSHV-MMKGNIQMSA-N |
| XLogP | 1.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|