C17H20O7 — CID 10893046
[(3S,4S,5R,6S)-5-acetyloxy-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 10893046) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-5-acetyloxy-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(3S,4S,5R,6S)-5-acetyloxy-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10893046 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [(3S,4S,5R,6S)-5-acetyloxy-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@H]1OC[C@H](OC(=O)c2ccccc2)[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H20O7/c1-3-9-21-17-15(23-11(2)18)14(19)13(10-22-17)24-16(20)12-7-5-4-6-8-12/h3-8,13-15,17,19H,1,9-10H2,2H3/t13-,14-,15+,17-/m0/s1 |
| InChIKey | NPGGRDQPHIPTQQ-MPTYRVRUSA-N |
| XLogP | 1.06 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|