C19H20O6 — CID 102458437
[(3S,4R,5R,6R)-4,5-dihydroxy-6-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 102458437) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-dihydroxy-6-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R)-4,5-dihydroxy-6-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102458437 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-dihydroxy-6-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1CO[C@@H](OCc2ccccc2)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H20O6/c20-16-15(25-18(22)14-9-5-2-6-10-14)12-24-19(17(16)21)23-11-13-7-3-1-4-8-13/h1-10,15-17,19-21H,11-12H2/t15-,16-,17+,19+/m0/s1 |
| InChIKey | YLVMSZPIGARVCG-IMBTUZDBSA-N |
| XLogP | 1.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |