C17H24O9 — CID 155889463
2-(4,5-dihydroxy-6-phenylmethoxyoxan-3-yl)oxyoxane-3,4,5-triol (PubChem CID 155889463) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-6-phenylmethoxyoxan-3-yl)oxyoxane-3,4,5-triol.
| Compound Name | 2-(4,5-dihydroxy-6-phenylmethoxyoxan-3-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 155889463 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(4,5-dihydroxy-6-phenylmethoxyoxan-3-yl)oxyoxane-3,4,5-triol |
| SMILES | OC1COC(OC2COC(OCc3ccccc3)C(O)C2O)C(O)C1O |
| InChI | InChI=1S/C17H24O9/c18-10-7-24-17(14(21)12(10)19)26-11-8-25-16(15(22)13(11)20)23-6-9-4-2-1-3-5-9/h1-5,10-22H,6-8H2 |
| InChIKey | COVJUVXXRSHKFY-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |