C12H15BrO4 — CID 125469481
(2S,3S,4R,5R)-5-bromo-2-phenylmethoxyoxane-3,4-diol (PubChem CID 125469481) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-bromo-2-phenylmethoxyoxane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-5-bromo-2-phenylmethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 125469481 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (2S,3S,4R,5R)-5-bromo-2-phenylmethoxyoxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)OC[C@@H](Br)[C@@H]1O |
| InChI | InChI=1S/C12H15BrO4/c13-9-7-17-12(11(15)10(9)14)16-6-8-4-2-1-3-5-8/h1-5,9-12,14-15H,6-7H2/t9-,10+,11+,12+/m1/s1 |
| InChIKey | YSDLGIIFWAUNHX-RHYQMDGZSA-N |
| XLogP | 1.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|