C12H14O4 — CID 15939647
(1S,4S,5S,6R)-4-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 15939647) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1S,4S,5S,6R)-4-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (1S,4S,5S,6R)-4-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 15939647 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1S,4S,5S,6R)-4-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)OC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C12H14O4/c13-10-11-9(16-11)7-15-12(10)14-6-8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10-,11-,12-/m0/s1 |
| InChIKey | HNEAZOAYLSDFTC-BJDJZHNGSA-N |
| XLogP | 0.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|