C13H14O3S3 — CID 101223208
(3aS,6S,7S,7aR)-7-hydroxy-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dithiolo[4,5-c]pyran-2-thione (PubChem CID 101223208) has the molecular formula C13H14O3S3 and a molecular weight of 314.45 g/mol. Its IUPAC name is (3aS,6S,7S,7aR)-7-hydroxy-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dithiolo[4,5-c]pyran-2-thione.
| Compound Name | (3aS,6S,7S,7aR)-7-hydroxy-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dithiolo[4,5-c]pyran-2-thione |
|---|---|
| PubChem CID | 101223208 |
| Molecular Formula | C13H14O3S3 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (3aS,6S,7S,7aR)-7-hydroxy-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dithiolo[4,5-c]pyran-2-thione |
| SMILES | O[C@H]1[C@@H](OCc2ccccc2)OC[C@@H]2SC(=S)S[C@H]12 |
| InChI | InChI=1S/C13H14O3S3/c14-10-11-9(18-13(17)19-11)7-16-12(10)15-6-8-4-2-1-3-5-8/h1-5,9-12,14H,6-7H2/t9-,10+,11-,12-/m0/s1 |
| InChIKey | DIKRNNNJUPZHMD-USZNOCQGSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|