C34H36O6 — CID 59435860
(1S,3R,4R)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexane-1,2-diol (PubChem CID 59435860) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (1S,3R,4R)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexane-1,2-diol.
| Compound Name | (1S,3R,4R)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 59435860 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (1S,3R,4R)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexane-1,2-diol |
| SMILES | OC1C(OCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C34H36O6/c35-29-30(36)32(38-22-26-15-7-2-8-16-26)34(40-24-28-19-11-4-12-20-28)33(39-23-27-17-9-3-10-18-27)31(29)37-21-25-13-5-1-6-14-25/h1-20,29-36H,21-24H2/t29-,30?,31?,32?,33?,34+/m0/s1 |
| InChIKey | VQNWAWRYJQHLAV-ZWQCVFAESA-N |
| XLogP | 5.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |