C33H35NO5 — CID 10649774
(1R,2R,3R,4S,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxyamino)cyclopentan-1-ol (PubChem CID 10649774) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxyamino)cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4S,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxyamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10649774 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (1R,2R,3R,4S,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxyamino)cyclopentan-1-ol |
| SMILES | O[C@@H]1[C@@H](NOCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO5/c35-30-29(34-39-24-28-19-11-4-12-20-28)31(36-21-25-13-5-1-6-14-25)33(38-23-27-17-9-3-10-18-27)32(30)37-22-26-15-7-2-8-16-26/h1-20,29-35H,21-24H2/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | FMGBWIWLKSJZSM-IZDBAANZSA-N |
| XLogP | 5.21 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|