C38H45NO5 — CID 11734665
(1S,2S,3S,4R,5R,6S)-2-(butylamino)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11734665) has the molecular formula C38H45NO5 and a molecular weight of 595.78 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R,6S)-2-(butylamino)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1S,2S,3S,4R,5R,6S)-2-(butylamino)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11734665 |
| Molecular Formula | C38H45NO5 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | (1S,2S,3S,4R,5R,6S)-2-(butylamino)-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CCCCN[C@H]1[C@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H45NO5/c1-2-3-24-39-33-34(40)36(42-26-30-18-10-5-11-19-30)38(44-28-32-22-14-7-15-23-32)37(43-27-31-20-12-6-13-21-31)35(33)41-25-29-16-8-4-9-17-29/h4-23,33-40H,2-3,24-28H2,1H3/t33-,34-,35-,36-,37+,38+/m0/s1 |
| InChIKey | VNJLZTFRIWSZHJ-AEKIIXOMSA-N |
| XLogP | 6.46 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|