C31H39NO5 — CID 11730863
(1R,3S,4R,6S)-2-(diethylamino)-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol (PubChem CID 11730863) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (1R,3S,4R,6S)-2-(diethylamino)-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol.
| Compound Name | (1R,3S,4R,6S)-2-(diethylamino)-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11730863 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (1R,3S,4R,6S)-2-(diethylamino)-4,5,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
| SMILES | CCN(CC)C1[C@@H](O)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C31H39NO5/c1-3-32(4-2)26-27(33)29(35-20-23-14-8-5-9-15-23)31(37-22-25-18-12-7-13-19-25)30(28(26)34)36-21-24-16-10-6-11-17-24/h5-19,26-31,33-34H,3-4,20-22H2,1-2H3/t26?,27-,28+,29+,30-,31? |
| InChIKey | SATQZKSPKFYINC-YNSVXXIFSA-N |
| XLogP | 4.19 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |