C29H34O4 — CID 118000060
(1R,2S,4S)-2,4-dimethyl-3,5,6-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 118000060) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (1R,2S,4S)-2,4-dimethyl-3,5,6-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2S,4S)-2,4-dimethyl-3,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 118000060 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (1R,2S,4S)-2,4-dimethyl-3,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CC1C(OCc2ccccc2)C(OCc2ccccc2)[C@H](O)[C@H](C)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O4/c1-21-26(30)29(33-20-25-16-10-5-11-17-25)28(32-19-24-14-8-4-9-15-24)22(2)27(21)31-18-23-12-6-3-7-13-23/h3-17,21-22,26-30H,18-20H2,1-2H3/t21-,22?,26+,27?,28?,29?/m0/s1 |
| InChIKey | XXIGRPWMPPSHKB-UISZBFMBSA-N |
| XLogP | 5.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |