C24H30O5 — CID 14375665
(3aS,4S,5S,6R,7S,7aR)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol (PubChem CID 14375665) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3aS,4S,5S,6R,7S,7aR)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4S,5S,6R,7S,7aR)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 14375665 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (3aS,4S,5S,6R,7S,7aR)-2,2,5-trimethyl-6,7-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C24H30O5/c1-16-19(25)21-23(29-24(2,3)28-21)22(27-15-18-12-8-5-9-13-18)20(16)26-14-17-10-6-4-7-11-17/h4-13,16,19-23,25H,14-15H2,1-3H3/t16?,19-,20+,21-,22-,23-/m0/s1 |
| InChIKey | UWNBJFICROZTRV-MCMQXRRFSA-N |
| XLogP | 3.69 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |