C20H28O6 — CID 11740029
(1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-7-phenylmethoxy-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-8-ol (PubChem CID 11740029) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-7-phenylmethoxy-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-8-ol.
| Compound Name | (1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-7-phenylmethoxy-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-8-ol |
|---|---|
| PubChem CID | 11740029 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-7-phenylmethoxy-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-8-ol |
| SMILES | CC1(C)OC[C@@H]2C(O)[C@@H](OCc3ccccc3)[C@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H28O6/c1-19(2)23-11-13-14(21)16(22-10-12-8-6-5-7-9-12)18-17(15(13)24-19)25-20(3,4)26-18/h5-9,13-18,21H,10-11H2,1-4H3/t13-,14?,15-,16-,17+,18-/m1/s1 |
| InChIKey | XHAWNGQQJLUMDJ-BIFHNEBASA-N |
| XLogP | 2.23 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |