C16H23NO5 — CID 12840404
7-amino-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 12840404) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | 7-amino-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 12840404 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 7-amino-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CC1(C)OCC2OC(OCc3ccccc3)C(N)C(O)C2O1 |
| InChI | InChI=1S/C16H23NO5/c1-16(2)20-9-11-14(22-16)13(18)12(17)15(21-11)19-8-10-6-4-3-5-7-10/h3-7,11-15,18H,8-9,17H2,1-2H3 |
| InChIKey | MKWVOCKAMGNAAQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |