C19H26O6 — CID 14409479
(1S,3S,7S,9R)-5,5,11,11-tetramethyl-8-phenylmethoxy-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol (PubChem CID 14409479) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (1S,3S,7S,9R)-5,5,11,11-tetramethyl-8-phenylmethoxy-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol.
| Compound Name | (1S,3S,7S,9R)-5,5,11,11-tetramethyl-8-phenylmethoxy-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
|---|---|
| PubChem CID | 14409479 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (1S,3S,7S,9R)-5,5,11,11-tetramethyl-8-phenylmethoxy-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
| SMILES | CC1(C)O[C@@H]2C(OCc3ccccc3)[C@@H]3OC(C)(C)O[C@H]3C(O)[C@@H]2O1 |
| InChI | InChI=1S/C19H26O6/c1-18(2)22-13-12(20)14-17(25-19(3,4)23-14)15(16(13)24-18)21-10-11-8-6-5-7-9-11/h5-9,12-17,20H,10H2,1-4H3/t12?,13-,14-,15?,16-,17+/m0/s1 |
| InChIKey | KWQJPCFJDMBLIR-OKZUVXGGSA-N |
| XLogP | 1.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |