C30H34O5 — CID 71094798
(4S,5S,7aR)-2,2-dimethyl-4,5,7-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (PubChem CID 71094798) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (4S,5S,7aR)-2,2-dimethyl-4,5,7-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole.
| Compound Name | (4S,5S,7aR)-2,2-dimethyl-4,5,7-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 71094798 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (4S,5S,7aR)-2,2-dimethyl-4,5,7-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| SMILES | CC1(C)OC2[C@H](O1)C(OCc1ccccc1)C[C@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C30H34O5/c1-30(2)34-28-26(32-20-23-14-8-4-9-15-23)18-25(31-19-22-12-6-3-7-13-22)27(29(28)35-30)33-21-24-16-10-5-11-17-24/h3-17,25-29H,18-21H2,1-2H3/t25-,26?,27-,28+,29?/m0/s1 |
| InChIKey | FPJYBTCRVHKBAD-IFQGCGCYSA-N |
| XLogP | 5.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |