C19H20O3 — CID 15567135
(1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-6-oxabicyclo[3.1.0]hexane (PubChem CID 15567135) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 15567135 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-6-oxabicyclo[3.1.0]hexane |
| SMILES | c1ccc(CO[C@H]2C[C@@H](OCc3ccccc3)[C@@H]3O[C@@H]32)cc1 |
| InChI | InChI=1S/C19H20O3/c1-3-7-14(8-4-1)12-20-16-11-17(19-18(16)22-19)21-13-15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17+,18+,19- |
| InChIKey | PJQRDYKQQBDOSO-SEXKYXSUSA-N |
| XLogP | 3.33 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|